Products Categories
| CAS No.: | 164666-68-6 |
|---|---|
| Name: | 3-Amino-6-chloro-2-picoline |
| Article Data: | 9 |
| Cas Database | |
| Molecular Structure: | |
|
|
|
| Formula: | C6H7ClN2 |
| Molecular Weight: | 142.59 |
| Synonyms: | (6-Chloro-2-methylpyridin-3-yl)amine;5-Amino-2-chloro-6-methylpyridine;6-Chloro-2-methyl-3-pyridinamine;6-Chloro-2-methylpyridin-3-amine; |
| Density: | 1.26 g/cm3 |
| Melting Point: | 93-94℃ |
| Boiling Point: | 286 °C at 760 mmHg |
| Flash Point: | 126.7 °C |
| Hazard Symbols: |
 Xi, T
|
| Risk Codes: | Xi:Irritant; ">  Xi:Irritant; |
| Safety: | 26-39-36/37-24/25 |
| PSA: | 38.91000 |
| LogP: | 2.20680 |
- 16466-97-0Magnesium,bromo-1-propynyl- (8CI,9CI)
- 164670-44-4Thiourea,N-4-pyridinyl-
- 1646-75-9Propanal,2-methyl-2-(methylthio)-, oxime
- 16469-17-3Neodymium hydroxide(Nd(OH)3)
- 16469-18-4Gadolinium hydroxide(Gd(OH)3)
- 16470-24-9Benzenesulfonic acid,2,2'-(1,2-ethenediyl)bis[5-[[4-[bis(2-hydroxyethyl)amino]-6-[(4-sulfophenyl)amino]-1,3,5-triazin-2-yl]amino]-,sodium salt (1:4)
- 1647-08-11-Hexene, 4,4-dimethyl-
- 1647-16-11,9-Decadiene
- 1647-23-0Butane,1-bromo-3,3-dimethyl-
- 1647-26-3Cyclohexane,(2-bromoethyl)-
What can I do for you?
Get Best Price
Specification
The 3-Amino-6-chloro-2-picoline is an organic compound with the formula C6H7ClN2. The IUPAC name of this chemical is 6-chloro-2-methylpyridin-3-amine. With the CAS registry number 164666-68-6, it is also named as 3-Pyridinamine, 6-chloro-2-methyl-. The product's categories are Pyridine; Halide; Pyridine Series; Pyridines; Boronic Acid; Amino-pyridine Series.
The other characteristics of 3-Amino-6-chloro-2-picoline can be summarized as: (1)ACD/LogP: 1.34; (2)# of Rule of 5 Violations: 0; (3)ACD/LogD (pH 5.5): 1.34; (4)ACD/LogD (pH 7.4): 1.34; (5)ACD/BCF (pH 5.5): 6.1; (6)ACD/BCF (pH 7.4): 6.11; (7)ACD/KOC (pH 5.5): 127.02; (8)ACD/KOC (pH 7.4): 127.12; (9)#H bond acceptors: 2; (10)#H bond donors: 2; (11)#Freely Rotating Bonds: 1; (12)Polar Surface Area: 16.13 Å2; (13)Index of Refraction: 1.592; (14)Molar Refractivity: 38.3 cm3; (15)Molar Volume: 113.1 cm3; (16)Polarizability: 15.18×10-24 cm3; (17)Surface Tension: 49.9 dyne/cm; (18)Enthalpy of Vaporization: 52.5 kJ/mol; (19)Vapour Pressure: 0.00272 mmHg at 25°C; (20)Exact Mass: 142.029776; (21)MonoIsotopic Mass: 142.029776; (22)Topological Polar Surface Area: 38.9; (23)Heavy Atom Count: 9; (24)Complexity: 97.1.
People can use the following data to convert to the molecule structure.
1. SMILES:Clc1nc(c(N)cc1)C
2. InChI:InChI=1/C6H7ClN2/c1-4-5(8)2-3-6(7)9-4/h2-3H,8H2,1H3
3. InChIKey:QVCIIOZINFCMDJ-UHFFFAOYAN
4. Std. InChI:InChI=1S/C6H7ClN2/c1-4-5(8)2-3-6(7)9-4/h2-3H,8H2,1H3
5. Std. InChIKey:QVCIIOZINFCMDJ-UHFFFAOYSA-N