Products Categories
CAS No.: | 7631-94-9 |
---|---|
Name: | SODIUM DITHIONATE |
Molecular Structure: | |
|
|
Formula: | H2NaO6S2 |
Molecular Weight: | 185.132 |
Synonyms: | Dithionicacid, disodium salt (8CI,9CI);Sodium dithionate (6CI,7CI);Disodiumdithionate;Sodium hyposulfate;Sodium sulfate (Na2S2O6); |
EINECS: | 231-550-1 |
Density: | 2.189 [MER06] |
Solubility: | H2O, w/w: 6.05% (0°C), 13.39% (20°C), 17.32 (30°C); insoluble alcohol [MER06] |
Appearance: | solid |
PSA: | 131.16000 |
LogP: | 0.15340 |
The CAS registry number of Dithionic acid, sodiumsalt (1:2) is 7631-94-9. This chemical is also named as Disodium dithionate. Its EINECS registry number is 231-550-1. In addition, its molecular formula is H2NaO6S2 and molecular weight is 185.132.
You can still convert the following datas into molecular structure:
(1)SMILES: OS(=O)(=O)S(=O)(=O)O.[NaH]
(2)InChI: InChI=1/Na.H2O6S2.H/c;1-7(2,3)8(4,5)6;/h;(H,1,2,3)(H,4,5,6);/rHNa.H2O6S2/c;1-7(2,3)8(4,5)6/h1H;(H,1,2,3)(H,4,5,6)
(3)InChIKey: DFIHIGZSHSQCIQ-RKNOUVEUAT