1003-91-4 Usage
Description
2,4,5-TRIBROMO-1-METHYL-1H-IMIDAZOLE is a halogenated imidazole derivative with the molecular formula C6H4Br3N2. It is known for its high thermal stability and is commonly used as a flame retardant in various products such as plastics, textiles, and electronics. This chemical compound effectively reduces the flammability of materials, making it a valuable additive in preventing fires. Additionally, it is utilized in some industrial processes and serves as an intermediate in the production of other chemicals. However, due to its potential environmental and health hazards, the use and handling of 2,4,5-TRIBROMO-1-METHYL-1H-IMIDAZOLE are strictly regulated.
Uses
Used in Plastics Industry:
2,4,5-TRIBROMO-1-METHYL-1H-IMIDAZOLE is used as a flame retardant for plastics to enhance their fire resistance and prevent the spread of flames in case of a fire. Its high thermal stability makes it an effective additive in this industry.
Used in Textile Industry:
In the textile industry, 2,4,5-TRIBROMO-1-METHYL-1H-IMIDAZOLE is used as a flame retardant to improve the fire safety of fabrics and garments. It helps in reducing the flammability of textiles, thereby providing an additional layer of protection against fire hazards.
Used in Electronics Industry:
2,4,5-TRIBROMO-1-METHYL-1H-IMIDAZOLE is utilized as a flame retardant in the electronics industry to minimize the risk of fire in electronic devices and components. Its ability to reduce flammability ensures the safety and reliability of electronic products.
Used in Industrial Processes:
2,4,5-TRIBROMO-1-METHYL-1H-IMIDAZOLE is employed in some industrial processes as a chemical intermediate. Its unique properties make it suitable for various applications, contributing to the efficiency and effectiveness of these processes.
Used in Chemical Production:
As an intermediate in the production of other chemicals, 2,4,5-TRIBROMO-1-METHYL-1H-IMIDAZOLE plays a crucial role in the synthesis of various compounds. Its presence in the chemical production process aids in the creation of new and innovative products with diverse applications.
Check Digit Verification of cas no
The CAS Registry Mumber 1003-91-4 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 1,0,0 and 3 respectively; the second part has 2 digits, 9 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 1003-91:
(6*1)+(5*0)+(4*0)+(3*3)+(2*9)+(1*1)=34
34 % 10 = 4
So 1003-91-4 is a valid CAS Registry Number.
InChI:InChI=1/C4H3Br3N2/c1-9-3(6)2(5)8-4(9)7/h1H3