103-94-6 Usage
Uses
Used in Pharmaceutical Industry:
4-Nitrophenyloxamic Acid is used as an antiviral agent for its inhibitory effects on neuraminidase of Newcastle disease virus Kudu 113 strain. By inhibiting the neuraminidase enzyme, 4-NITROPHENYLOXAMIC ACID can potentially limit the replication and spread of the virus, making it a valuable tool in the development of antiviral therapies.
Used in Research and Development:
4-Nitrophenyloxamic Acid can be utilized in research settings to study the structure, function, and inhibition of neuraminidase enzymes. This can contribute to a better understanding of the mechanisms underlying viral replication and the development of novel antiviral drugs.
Used in Diagnostic Applications:
Due to its inhibitory effects on neuraminidase, 4-Nitrophenyloxamic Acid can be employed in diagnostic assays to detect the presence of neuraminidase enzymes or the activity of neuraminidase inhibitors. This can be particularly useful in the early detection and monitoring of viral infections.
Uses
Used in Organic Chemistry Research:
4-NITROPHENYLOXAMIC ACID is used as a research compound for its unique structure and reactivity, contributing to the advancement of organic chemistry.
Used in Chemical Synthesis:
4-NITROPHENYLOXAMIC ACID is used as an intermediate in the synthesis of other organic compounds, facilitating the creation of complex molecules and contributing to the development of new chemical entities.
Used in Chemical Reactions:
4-NITROPHENYLOXAMIC ACID is used as a reactant in various chemical reactions, potentially leading to the formation of new compounds with specific properties and applications.
Check Digit Verification of cas no
The CAS Registry Mumber 103-94-6 includes 6 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 3 digits, 1,0 and 3 respectively; the second part has 2 digits, 9 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 103-94:
(5*1)+(4*0)+(3*3)+(2*9)+(1*4)=36
36 % 10 = 6
So 103-94-6 is a valid CAS Registry Number.
InChI:InChI=1/C8H6N2O5/c11-7(8(12)13)9-5-1-3-6(4-2-5)10(14)15/h1-4H,(H,9,11)(H,12,13)
103-94-6Relevant academic research and scientific papers
Cerium (IV) mediated oxidative dimerization of 3-oxoacid anilides and their cyclizations
Zaleska,Lis
, p. 189 - 197 (2007/10/03)
Investigation of the behavior of several anilides of 3-oxoacids in oxidation reaction with ceric ammonium nitrate has shown that selective intermolecular C-C bond formation, which led to their dimers, is typical of these compounds. These dimeric species were cyclized in two routes, A and B, leading to 3-[2′-(1′-aniline-3′-oxo)-indene]-quinoline-2-on derivatives with HCl(g) (Route A), and with application of H2SO4 as a cyclization agent, gave furane-3,4-dicarboxylic acid derivatives (Route B).
