24239-82-5 Usage
Description
1,3-Dibromo-4,6-dinitrobenzene is a substituted benzene derivative characterized by its yellow crystalline solid appearance. It is a chemical compound that plays a significant role in organic chemistry due to its versatile reactivity in various chemical reactions, such as nucleophilic substitution and aromatic nitration. The presence of two bromine atoms and two nitro groups in its structure endows it with unique properties that make it a valuable building block in the synthesis of a range of organic compounds.
Uses
Used in Dye and Pigment Production:
1,3-Dibromo-4,6-dinitrobenzene is used as a key intermediate in the synthesis of dyes and pigments, contributing to the coloration and stability of these products. Its chemical structure allows for the creation of a variety of dyes with different properties, making it an essential component in this industry.
Used in Pharmaceutical Manufacturing:
In the pharmaceutical industry, 1,3-Dibromo-4,6-dinitrobenzene serves as a building block for the synthesis of various medicinal compounds. Its reactivity and structural features enable the development of new drugs with specific therapeutic properties, contributing to the advancement of pharmaceutical chemistry.
Used in Agrochemical Production:
1,3-Dibromo-4,6-dinitrobenzene is also utilized in the agrochemical sector for the synthesis of pesticides and other agricultural chemicals. Its chemical properties make it suitable for the development of compounds that can effectively control pests and diseases in crops, thereby enhancing agricultural productivity.
Used in Organic Chemistry Research:
As a versatile reagent, 1,3-Dibromo-4,6-dinitrobenzene is widely used in organic chemistry research for studying various reaction mechanisms and exploring new synthetic pathways. Its unique structure allows researchers to investigate a range of chemical transformations, contributing to the understanding and development of organic chemistry.
Check Digit Verification of cas no
The CAS Registry Mumber 24239-82-5 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,4,2,3 and 9 respectively; the second part has 2 digits, 8 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 24239-82:
(7*2)+(6*4)+(5*2)+(4*3)+(3*9)+(2*8)+(1*2)=105
105 % 10 = 5
So 24239-82-5 is a valid CAS Registry Number.
InChI:InChI=1/C6H2Br2N2O4/c7-3-1-4(8)6(10(13)14)2-5(3)9(11)12/h1-2H
24239-82-5Relevant articles and documents
Indolo[2,3-b]carbazoles with tunable ground states: How Clar's aromatic sextet determines the singlet biradical character
Luo, Ding,Lee, Sangsu,Zheng, Bin,Sun, Zhe,Zeng, Wangdong,Huang, Kuo-Wei,Furukawa, Ko,Kim, Dongho,Webster, Richard D.,Wu, Jishan
, p. 4944 - 4952 (2014)
Polycyclic hydrocarbons (PHs) with a singlet biradical ground state have recently attracted extensive interest in physical organic chemistry and materials science. Replacing the carbon radical center in the open-shell PHs with a more electronegative nitro
CONDUCTING POLYMERS FOR DIRECT SENSING OF METAL IONS
-
Paragraph 0039; 0057, (2017/07/14)
The present invention provides an ion selective electrode comprising an electrode having a coating deposited on the electrode, wherein the coating comprises one or more aroyl-thiourea ionophores incorporated into a polymer matrix to selectively interact w
Cyclization of acetylenic amides using a cationic rhodium(I) complex
Burling, Suzanne,Field, Leslie D.,Li, Hsiu L.,Messerle, Barbara A.,Shasha, Adelle
, p. 677 - 680 (2007/10/03)
The cationic Rh(I) dicarbonyl complex [{Rh(bim)(CO)2} +BPh4-] 1, containing a bidentate bisimidazolylmethane ligand [bim refers to bis(N-methylimidazol-2-yl)methane] acts as a catalyst for the cyclization of alkynyl amides to produce lactams and N-acyl heterocyclic compounds.
