24305-56-4 Usage
Uses
4-N-Dodecylresorcinol is used as a reactant in organic synthesis for its unique chemical properties. The expression is: 4-N-Dodecylresorcinol is used as a reactant in organic synthesis for its unique chemical properties.
Used in Chemical Industry:
4-N-Dodecylresorcinol is used as a building block in the chemical industry for the synthesis of various compounds due to its versatile chemical structure and reactivity.
Used in Pharmaceutical Industry:
4-N-Dodecylresorcinol can be used as an intermediate in the development of pharmaceutical compounds, taking advantage of its unique chemical properties to create new drugs with potential therapeutic applications.
Used in Cosmetics Industry:
Due to its chemical properties, 4-N-Dodecylresorcinol may also find applications in the cosmetics industry, potentially being used in the formulation of skincare products or other cosmetic formulations.
Used in Material Science:
The unique properties of 4-N-Dodecylresorcinol may also make it a valuable component in the development of new materials with specific characteristics, such as improved solubility, stability, or reactivity.
Check Digit Verification of cas no
The CAS Registry Mumber 24305-56-4 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,4,3,0 and 5 respectively; the second part has 2 digits, 5 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 24305-56:
(7*2)+(6*4)+(5*3)+(4*0)+(3*5)+(2*5)+(1*6)=84
84 % 10 = 4
So 24305-56-4 is a valid CAS Registry Number.
InChI:InChI=1/C18H30O2/c1-2-3-4-5-6-7-8-9-10-11-12-16-13-14-17(19)15-18(16)20/h13-15,19-20H,2-12H2,1H3
