34771-17-0 Usage
Uses
Used in Pharmaceutical Industry:
5-Amino-6-thioxodihydropyrimidine-2,4(1H,3H)-dione is used as a precursor in the synthesis of pharmaceuticals for its ability to form the base structure of barbiturates and uracil derivatives. These compounds have various therapeutic applications, including sedation, hypnotism, and anticonvulsant effects.
Used in Dye Production:
In the chemical industry, 5-Amino-6-thioxodihydropyrimidine-2,4(1H,3H)-dione is utilized as a precursor in the production of dyes. Its unique chemical structure allows for the creation of a wide range of dye colors, making it a valuable component in the dye manufacturing process.
Used in Organic Compound Synthesis:
5-Amino-6-thioxodihydropyrimidine-2,4(1H,3H)-dione is employed as a building block in the synthesis of other organic compounds. Its versatile chemical properties enable the formation of various organic molecules, contributing to the development of new chemical entities with potential applications in various fields.
Used in Enzyme Inhibition:
5-Amino-6-thioxodihydropyrimidine-2,4(1H,3H)-dione acts as a moderate inhibitor of the enzyme dihydrofolate reductase, which plays a crucial role in the production of tetrahydrofolate, a critical precursor for DNA and RNA synthesis. This inhibitory effect can be leveraged in the development of drugs targeting specific metabolic pathways in disease treatment.
Check Digit Verification of cas no
The CAS Registry Mumber 34771-17-0 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 3,4,7,7 and 1 respectively; the second part has 2 digits, 1 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 34771-17:
(7*3)+(6*4)+(5*7)+(4*7)+(3*1)+(2*1)+(1*7)=120
120 % 10 = 0
So 34771-17-0 is a valid CAS Registry Number.
InChI:InChI=1/C4H5N3O2S/c5-1-2(8)6-4(9)7-3(1)10/h1H,5H2,(H2,6,7,8,9,10)
