4215-07-0 Usage
General Description
2,4-Pteridinediamine,7-methyl-(9CI) is a chemical compound also known by its numerical identifier 22722-10-7. It is a derivative of pteridine and is classified as a heterocyclic compound. Its molecular formula is C7H8N6 and it has a molecular weight of 164.18 g/mol. The chemical is commonly used in organic synthesis and pharmaceutical research as a building block for the synthesis of various bioactive compounds. Its specific properties and applications in various industries are currently being studied and researched for further development.
Check Digit Verification of cas no
The CAS Registry Mumber 4215-07-0 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 4,2,1 and 5 respectively; the second part has 2 digits, 0 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 4215-07:
(6*4)+(5*2)+(4*1)+(3*5)+(2*0)+(1*7)=60
60 % 10 = 0
So 4215-07-0 is a valid CAS Registry Number.
InChI:InChI=1/C7H8N6/c1-3-2-10-4-5(8)12-7(9)13-6(4)11-3/h2H,1H3,(H4,8,9,11,12,13)