4371-64-6 Usage
General Description
2-HEXADECYL-MALONIC ACID is a long-chain carboxylic acid that contains both a malonic acid group and a hexadecyl group. It is a compound with potential uses in the pharmaceutical and cosmetic industries due to its surfactant properties and ability to form micelles. As a surfactant, it can reduce surface tension and improve the solubility of poorly soluble compounds. Additionally, the presence of the malonic acid group suggests potential use in drug delivery systems, as malonic acid derivatives have been shown to enhance the stability and bioavailability of certain drugs. Overall, 2-HEXADECYL-MALONIC ACID has potential applications in a range of industries due to its unique chemical structure and surfactant properties.
Check Digit Verification of cas no
The CAS Registry Mumber 4371-64-6 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 4,3,7 and 1 respectively; the second part has 2 digits, 6 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 4371-64:
(6*4)+(5*3)+(4*7)+(3*1)+(2*6)+(1*4)=86
86 % 10 = 6
So 4371-64-6 is a valid CAS Registry Number.
InChI:InChI=1/C19H36O4/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17(18(20)21)19(22)23/h17H,2-16H2,1H3,(H,20,21)(H,22,23)
