563-67-7 Usage
Uses
Used in Catalyst Support Modification:
Rubidium acetate is used as a modifier for catalyst supports like silica, alumina, and titania to enhance their acid/base character. This modification improves the performance of these catalyst supports in various chemical reactions.
Used in the Preparation of Nanosized Rubidium Ferrite:
Rubidium acetate is utilized in the synthesis of nanosized rubidium ferrite, which has potential applications in various industries due to its unique magnetic properties.
Used as a Promoter in the Palladium-Catalyzed Synthesis of Vinyl Acetate:
In the chemical industry, rubidium acetate serves as a promoter in the palladium-catalyzed synthesis of vinyl acetate in heterogeneous gas reactions. Its presence enhances the efficiency and selectivity of the reaction, leading to improved product yields.
Used in Medical Applications:
Rubidium acetate finds use in the medical field, where it can be employed in various diagnostic and therapeutic applications due to its unique chemical properties.
Used in Research Laboratories:
In research settings, rubidium acetate is a valuable compound for conducting experiments and studying its effects on different chemical processes and reactions. Its ability to modify catalyst supports and promote specific reactions makes it an essential tool for scientific inquiry.
Check Digit Verification of cas no
The CAS Registry Mumber 563-67-7 includes 6 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 3 digits, 5,6 and 3 respectively; the second part has 2 digits, 6 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 563-67:
(5*5)+(4*6)+(3*3)+(2*6)+(1*7)=77
77 % 10 = 7
So 563-67-7 is a valid CAS Registry Number.
InChI:InChI=1/C2H4O2.Rb/c1-2(3)4;/h1H3,(H,3,4);/q;+1/p-1