63572-73-6 Usage
Uses
Used in Pharmaceutical Applications:
5-Nitro-1H-pyrazolo[3,4-b]pyridine is used as a potential anti-inflammatory agent for its ability to modulate inflammatory responses, which can be beneficial in treating various inflammatory conditions.
Used in Antitumor Applications:
In the field of oncology, 5-Nitro-1H-pyrazolo[3,4-b]pyridine is used as a potential antitumor agent, showing promise in inhibiting the growth and proliferation of cancer cells, thereby contributing to cancer treatment strategies.
Used in Enzyme Inhibition:
5-Nitro-1H-pyrazolo[3,4-b]pyridine is utilized as an enzyme inhibitor, targeting specific biological enzymes that play a role in various diseases. Its ability to inhibit these enzymes can lead to the development of new therapeutic approaches for treating enzyme-related disorders.
Used in Research and Development:
In the scientific community, 5-Nitro-1H-pyrazolo[3,4-b]pyridine serves as a subject of interest for further research and development. Its unique chemical structure and properties make it a valuable compound for exploring new pharmaceutical and medical applications, potentially leading to the discovery of novel treatments and therapies.
Check Digit Verification of cas no
The CAS Registry Mumber 63572-73-6 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,3,5,7 and 2 respectively; the second part has 2 digits, 7 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 63572-73:
(7*6)+(6*3)+(5*5)+(4*7)+(3*2)+(2*7)+(1*3)=136
136 % 10 = 6
So 63572-73-6 is a valid CAS Registry Number.
InChI:InChI=1/C6H4N4O2/c11-10(12)5-1-4-2-8-9-6(4)7-3-5/h1-3H,(H,7,8,9)
