770-30-9 Usage
Description
4-AMINO-2-(METHYLTHIO)PYRIMIDINE-5-CARBONITRILE is a slightly yellow to cream powder that serves as a pharmaceutical intermediate. It is a chemical compound with the molecular formula C6H7N5S, characterized by the presence of an amino group, a methylthio group, and a carbonitrile group attached to a pyrimidine ring.
Uses
Used in Pharmaceutical Industry:
4-AMINO-2-(METHYLTHIO)PYRIMIDINE-5-CARBONITRILE is used as a pharmaceutical intermediate for the synthesis of various therapeutic agents. Its unique chemical structure allows it to be a key component in the development of drugs targeting specific biological pathways and diseases.
As a pharmaceutical intermediate, 4-AMINO-2-(METHYLTHIO)PYRIMIDINE-5-CARBONITRILE plays a crucial role in the production of medications that address a wide range of health conditions. Its versatility in chemical reactions enables the creation of diverse drug candidates with potential applications in various therapeutic areas.
Check Digit Verification of cas no
The CAS Registry Mumber 770-30-9 includes 6 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 3 digits, 7,7 and 0 respectively; the second part has 2 digits, 3 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 770-30:
(5*7)+(4*7)+(3*0)+(2*3)+(1*0)=69
69 % 10 = 9
So 770-30-9 is a valid CAS Registry Number.
InChI:InChI=1/C6H7N3OS/c1-11-6-8-2-4(3-10)5(7)9-6/h2-3H,1H3,(H2,7,8,9)
770-30-9Relevant articles and documents
Synthesis and anticancer activity of novel 2-alkylthio-4-amino-5-(thiazol-2-YL)pyrimidines
Bunev, Alexander S.,Khochenkov, Dmitry A.,Khochenkova, Yulia A.,Machkova, Yulia S.,Varakina, Elena V.,Gasanov, Rovshan E.,Troshina, Marina A.,Avdyakova, Olga S.
supporting information, p. 2521 - 2527 (2021/06/25)
A series of new fist-time synthesized of thiazolyl-substituted 4-aminopyrimidine was obtained on the basis of a two-stage process including thioamidation of 4-amino-5-cyanopyrimide followed by one-pot acylation and Hantzsch synthesis in good yield (52–77%
DIVALENT NUCLEOBASE COMPOUNDS AND USES THEREFOR
-
Sheet 11/20, (2016/04/19)
Described herein are novel divalent nucleobases that each bind two nucleic acid strands, matched or mismatched when incorporated into a nucleic acid or nucleic acid analog backbone (a genetic recognition reagent, or genetic recognition reagent). In one embodiment, the genetic recognition reagent is a peptide nucleic acid (PNA) or gamma PNA (?PNA) oligomer. Uses of the divalent nucleobases and monomers and genetic recognition reagents containing the divalent nucleobases also are provided.