The Piperidine,3-phenyl-, (3R)-, with the CAS registry number 430461-56-6, is also known as (R)-3-Phenyl piperidine. This chemical's molecular formula is C₁₁H₁₅N and molecular weight is 161.120449. Its IUPAC name is called 3-phenylpiperidine.

Physical properties of Piperidine,3-phenyl-, (3R)-: (1)ACD/LogP: 2.38; (2)ACD/BCF (pH 5.5): 1; (3)ACD/BCF (pH 7.4): 1; (4)ACD/KOC (pH 5.5): 1; (5)ACD/KOC (pH 7.4): 1.508; (6)#H bond acceptors: 1; (7)#H bond donors: 1; (8)#Freely Rotating Bonds: 1; (9)Index of Refraction: 1.522; (10)Molar Refractivity: 50.851 cm³; (11)Molar Volume: 166.671 cm³; (12)Surface Tension: 35.352 dyne/cm; (13)Density: 0.967 g/cm³; (14)Flash Point: 115.488 °C; (15)Enthalpy of Vaporization: 50.1 kJ/mol; (16)Boiling Point: 263.183 °C at 760 mmHg; (17)Vapour Pressure: 0.01 mmHg at 25°C.

You can still convert the following datas into molecular structure:
(1)Canonical SMILES: C1CC(CNC1)C2=CC=CC=C2
(2)InChI: InChI=1S/C11H15N/c1-2-5-10(6-3-1)11-7-4-8-12-9-11/h1-3,5-6,11-12H,4,7-9H2
(3)InChIKey: NZYBILDYPCVNMU-UHFFFAOYSA-N