The 1,6-Naphthyridine with CAS registry number of 253-72-5 is also known as 1,6-Diazanaphthalene. The IUPAC name is 1,6-Naphthyridine. It belongs to product categories of Pyridine. This chemical may cause inflammation to the skin or other mucous membranes. In addition, the formula is C₈H₆N₂ and the molecular weight is 130.15.

Physical properties about 1,6-Naphthyridine are: (1)ACD/LogP: 0.59; (2)# of Rule of 5 Violations: 0; (3)ACD/LogD (pH 5.5): 0.58; (4)ACD/LogD (pH 7.4): 0.59; (5)ACD/BCF (pH 5.5): 1.63; (6)ACD/BCF (pH 7.4): 1.66; (7)ACD/KOC (pH 5.5): 49.04; (8)ACD/KOC (pH 7.4): 49.98; (9)#H bond acceptors: 2; (10)#H bond donors: 0; (11)#Freely Rotating Bonds: 0; (12)Polar Surface Area: 25.78Ų; (13)Index of Refraction: 1.653; (14)Molar Refractivity: 40.27 cm³; (15)Molar Volume: 109.9 cm³; (16)Polarizability: 15.96×10^-24cm³; (17)Surface Tension: 54.8 dyne/cm; (18)Density: 1.183 g/cm³; (19)Flash Point: 118.3 °C; (20)Enthalpy of Vaporization: 48.49 kJ/mol; (21)Boiling Point: 267.3 °C at 760 mmHg; (22)Vapour Pressure: 0.0136 mmHg at 25 °C.

Uses of 1,6-Naphthyridine: it is used to produce 6-acetyl-5-(2-oxo-propyl)-5,6-dihydro-[1,6]naphthyridine by reaction of acetic acid and propan-2-one. The reaction occurs at ambient temperature and the yield is about 62.2%.

You can still convert the following datas into molecular structure:
1. SMILES: n1cccc2c1ccnc2
2. InChI: InChI=1/C8H6N2/c1-2-7-6-9-5-3-8(7)10-4-1/h1-6H
3. InChIKey: VSOSXKMEQPYESP-UHFFFAOYAB
4. Std. InChI: InChI=1S/C8H6N2/c1-2-7-6-9-5-3-8(7)10-4-1/h1-6H
5. Std. InChIKey: VSOSXKMEQPYESP-UHFFFAOYSA-N