The 1H-Benzimidazol-2-amine,5,6-dichloro-, with the CAS registry number 18672-03-2, is also known as 2-Amino-5,6-dichlorobenzimidazole. It belongs to the product categories of Blocks; Imidazoles; Pharmacetical. This chemical's molecular formula is C₇H₅Cl₂N₃ and molecular weight is 202.0407. Its IUPAC name is called 5,6-dichloro-1H-benzimidazol-2-amine.

Physical properties of 1H-Benzimidazol-2-amine,5,6-dichloro-: (1)ACD/LogP: 2.85; (2)ACD/LogD (pH 5.5): 2.7; (3)ACD/LogD (pH 7.4): 2.81; (4)ACD/BCF (pH 5.5): 60.96; (5)ACD/BCF (pH 7.4): 79.08; (6)ACD/KOC (pH 5.5): 599.16; (7)ACD/KOC (pH 7.4): 777.25; (8)#H bond acceptors: 3; (9)#H bond donors: 3; (10)Index of Refraction: 1.775; (11)Molar Refractivity: 50.64 cm³; (12)Molar Volume: 121.2 cm³; (13)Surface Tension: 79.7 dyne/cm; (14)Density: 1.665 g/cm³; (15)Flash Point: 217.1 °C; (16)Enthalpy of Vaporization: 69.17 kJ/mol; (17)Boiling Point: 435.4 °C at 760 mmHg; (18)Vapour Pressure: 8.78E-08 mmHg at 25°C.

You can still convert the following datas into molecular structure:
(1)Canonical SMILES: C1=C2C(=CC(=C1Cl)Cl)N=C(N2)N
(2)InChI: InChI=1S/C7H5Cl2N3/c8-3-1-5-6(2-4(3)9)12-7(10)11-5/h1-2H,(H3,10,11,12)
(3)InChIKey: HAADRTMPUSJNOI-UHFFFAOYSA-N