The 2-Methyl propyl radical, with the CAS registry number of 7756-94-7, is also known as 2-Propanyl, 2-methyl-. Its molecular formula is C₄H₉ and molecular weight is 57.1143. What's more, its systematic name is tert-Butyl.

Physical properties about the 2-Methyl propyl radical are: (1)#H bond acceptors: 0; (2)#H bond donors: 0; (3)#Freely Rotating Bonds: 0; (4)Polar Surface Area: Å².

You can still convert the following datas into molecular structure:
(1) SMILES: C[C](C)C
(2) InChI: InChI=1/C4H9/c1-4(2)3/h1-3H3
(3) InChIKey: IIVWHGMLFGNMOW-UHFFFAOYAM