120-74-1 Usage
Uses
Used in Organic Synthesis:
5-Norbornene-2-carboxylic acid is used as a key intermediate for the synthesis of various organic compounds due to its unique bicyclic structure and reactivity.
Used in Pharmaceuticals:
In the pharmaceutical industry, 5-Norbornene-2-carboxylic acid is used as a building block for the development of new drugs, taking advantage of its chemical properties to create novel therapeutic agents.
Used in Agrochemicals:
5-Norbornene-2-carboxylic acid is utilized as a raw material in the production of agrochemicals, such as pesticides and herbicides, due to its ability to form stable and effective compounds.
Used in Dyestuff:
In the dyestuff industry, 5-Norbornene-2-carboxylic acid is employed as an intermediate for the synthesis of various dyes and pigments, contributing to the development of new colorants with improved properties.
Overall, 5-Norbornene-2-carboxylic acid is a versatile chemical with applications across multiple industries, making it a valuable compound for research and development purposes.
Check Digit Verification of cas no
The CAS Registry Mumber 120-74-1 includes 6 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 3 digits, 1,2 and 0 respectively; the second part has 2 digits, 7 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 120-74:
(5*1)+(4*2)+(3*0)+(2*7)+(1*4)=31
31 % 10 = 1
So 120-74-1 is a valid CAS Registry Number.
InChI:InChI=1/C8H10O2/c9-7(10)8-3-1-6(5-8)2-4-8/h1,3,6H,2,4-5H2,(H,9,10)