The N-Acetyl-O-methyl-serine, with the CAS registry number 98632-99-6, is also known as Serine, N-acetyl-O-methyl-. This chemical's molecular formula is C₆H₁₁NO₄ and molecular weight is 161.16. Its systematic name is called N-acetyl-O-methylserine.

Physical properties of N-Acetyl-O-methyl-serine: (1)ACD/BCF (pH 5.5): 1; (2)ACD/BCF (pH 7.4): 1; (3)ACD/KOC (pH 5.5): 1; (4)ACD/KOC (pH 7.4): 1; (5)#H bond acceptors: 5; (6)#H bond donors: 2; (7)#Freely Rotating Bonds: 4; (8)Index of Refraction: 1.457; (9)Molar Refractivity: 36.73 cm³; (10)Molar Volume: 134.8 cm³; (11)Surface Tension: 41.6 dyne/cm; (12)Density: 1.194 g/cm³; (13)Flash Point: 191.7 °C; (14)Enthalpy of Vaporization: 70.61 kJ/mol; (15)Boiling Point: 393.4 °C at 760 mmHg; (16)Vapour Pressure: 2.76E-07 mmHg at 25°C.

You can still convert the following datas into molecular structure:
(1)SMILES: O=C(O)C(NC(=O)C)COC
(2)InChI: InChI=1/C6H11NO4/c1-4(8)7-5(3-11-2)6(9)10/h5H,3H2,1-2H3,(H,7,8)(H,9,10)
(3)InChIKey: SDNGNSKFWTZCJG-UHFFFAOYAK