36980-91-3 Usage
General Description
1,3-DIMETHYL-5-CYANOURACIL, also known as 3,5-dimethyluracil, is a chemical compound with the molecular formula C6H6N4O2. It is a derivative of uracil and belongs to the class of pyrimidine nucleobases. 1,3-DIMETHYL-5-CYANOURACIL is used in the pharmaceutical industry as a building block for the synthesis of various pharmaceuticals and agrochemicals. It is also utilized as a precursor in the production of other chemicals and materials. 1,3-DIMETHYL-5-CYANOURACIL has potential applications in the field of medicinal chemistry and drug discovery, where it can be used as a starting material for the development of novel therapeutic agents. Additionally, it may have applications in the field of materials science, where it can be used in the synthesis of polymers and other materials with specific properties.
Check Digit Verification of cas no
The CAS Registry Mumber 36980-91-3 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 3,6,9,8 and 0 respectively; the second part has 2 digits, 9 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 36980-91:
(7*3)+(6*6)+(5*9)+(4*8)+(3*0)+(2*9)+(1*1)=153
153 % 10 = 3
So 36980-91-3 is a valid CAS Registry Number.
InChI:InChI=1/C7H7N3O2/c1-9-4-5(3-8)6(11)10(2)7(9)12/h4H,1-2H3
