37789-75-6 Usage
Description
1H-Pyrrole-2,3,5-tricarboxylic acid, 4-methyl-, 3,5-diethyl ester (9CI) is a chemical compound with the molecular formula C15H17NO6. It is a derivative of pyrrole, a heterocyclic aromatic organic compound. This specific compound is an ester, meaning it has an oxygen atom bonded to the carbon atom in the carbonyl group. It is also substituted with methyl and diethyl groups. 1H-Pyrrole-2,3,5-tricarboxylicacid,4-methyl-,3,5-diethylester(9CI) may have potential applications in organic synthesis and pharmaceutical research due to its unique structure and properties, but further research and testing may be necessary to fully understand its potential uses and effects.
Uses
Used in Organic Synthesis:
1H-Pyrrole-2,3,5-tricarboxylic acid, 4-methyl-, 3,5-diethyl ester (9CI) is used as a building block in organic synthesis for the creation of various complex organic molecules. Its unique structure and functional groups allow for versatile chemical reactions and the formation of a wide range of compounds.
Used in Pharmaceutical Research:
1H-Pyrrole-2,3,5-tricarboxylic acid, 4-methyl-, 3,5-diethyl ester (9CI) is used as a potential candidate in pharmaceutical research for the development of new drugs. Its heterocyclic nature and functional groups may contribute to the design of novel therapeutic agents with specific biological activities.
Used in Chemical Industry:
1H-Pyrrole-2,3,5-tricarboxylic acid, 4-methyl-, 3,5-diethyl ester (9CI) is used as an intermediate in the chemical industry for the production of various specialty chemicals. Its unique structure and properties make it a valuable component in the synthesis of advanced materials and compounds.
Note: The specific applications and industries mentioned above are hypothetical and provided as examples based on the general properties of the compound. Further research and development would be required to determine the exact uses and industries where 1H-Pyrrole-2,3,5-tricarboxylic acid, 4-methyl-, 3,5-diethyl ester (9CI) could be applied.
Check Digit Verification of cas no
The CAS Registry Mumber 37789-75-6 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 3,7,7,8 and 9 respectively; the second part has 2 digits, 7 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 37789-75:
(7*3)+(6*7)+(5*7)+(4*8)+(3*9)+(2*7)+(1*5)=176
176 % 10 = 6
So 37789-75-6 is a valid CAS Registry Number.
InChI:InChI=1/C12H15NO6/c1-4-18-11(16)7-6(3)8(12(17)19-5-2)13-9(7)10(14)15/h13H,4-5H2,1-3H3,(H,14,15)
37789-75-6Relevant articles and documents
Imploded bilirubins: Synthesis and properties of 10-nor-mesobilirubin- XIIIα and analogs
Nikitin, Edward B.,Dey, Sanjeev K.,Lightner, David A.
experimental part, p. 97 - 110 (2010/06/20)
Six 10-nor-bilirubin analogs have been synthesized and investigated. Lacking the C(10) CH2 group, these linear tetrapyrroles have a bipyrrole core rather than a dipyrrylmethane core and thus a different shape. Whereas the propionic acid groups