Journal of Organometallic Chemistry p. 183 - 193 (1996)
Update date:2022-08-02
Topics:
Lin, Jiann T.
Wang, Shiow Y.
Chou, Yung C.
Gong, Ming L.
Shiow, Yui-May
Gau, Han-Mou
Wen, Yuh S.
The complexes Co(NO)(CO)(Ph2PH)2 (1), Fe(NO)2(Ph2PH)2 (2) and Mn(NO)(CO)2(Ph2PH)2 (3) are synthesized from Co(NO)(CO)3, Fe(NO)2(CO)2 and Mn(NO)(CO)4 respectively. Deprotonation of 1 with two equivalents of BuLi followed by subsequent addition of methyl iodide, allyl bromide and propargyl bromide provides Co(NO)(CO)(Ph2PMe)2 (4), Co(NO)(CO)(Ph2PCH2CHCH2)2 (5) and Co(NO)(CO)(Ph2PCH2CCH)2 (6) respectively. X-ray crystal structure analyses for 1, 3 and 4-6 were carried out to give data as followed. 1: monoclinic; C2/c; Z = 4; a = 17.130(5), b = 9.894(2) and c = 42.607(1) A; β = 93.29(2)°; V = 7210(2) A3; R = 0.056; Rw = 0.058. 3: monoclinic; C2/c; Z = 4; a = 15.231(5), b = 10.247(2) and c = 16.311(2) A; β = 102.29(2)°; V= 2488(1) A3; R = 0.041; Rw = 0.042. 4: monoclinic; C2/c; Z = 4; a = 15.556(3), b = 12.072(1) and c = 14.809(2) A; β 114.43(1)°; V= 2532.0(7) A3; R = 0.032; Rw = 0.031. 5: monoclinic; P21/c; Z = 4; a = 15.427(2), b = 10.118(2) and c = 18.793(6) A; β = 102.56(1)°; V = 2863(1) A3; R = 0.042; Rw = 0.046. 6: monoclinic; P21/n; Z = 4; a = 9.3393(8), b = 19.035(4) and c = 16.007(1) A; β = 94.912(7)°; V= 2845.8(6) A3; R = 0.052; Rw = 0.059.
View MoreNanyang Tianhua pharmaceutical Co.,Ltd.
Contact:+8618639816203
Address:Longsheng Industrial Park
SuZhou Hua-Emy Chemical Import and Export Co., LTD.
Contact:+86-512-88804994; +86-512-88804550;
Address:710, Building B, International Trade Center, 12 Huanghelu, Changshu, Jiangsu,China
suzhou chukai pharmateach co,.ltd
Contact:86-512-88812511
Address:Building 3, Wujiang Scientific Innovation Park, 2358 Changan Rd, Wujiang 215200, Jiangsu Province, P. R. China
Shandong General Materials Co.,Ltd(Shandong Aoertong Chemical Co., Ltd)
Contact:86-531-88072280
Address:No. 1825 Hualong Road, Licheng District, Jinan, Shandong, China
Wuhan Fortuna Chemical Co.,Ltd
website:http://www.fortunachem.com
Contact:86-27-59207850
Address:Add: Room 2015, No.2 Building, Kaixin Mansion No.107 Jinqiao Avenue, Wuhan, China
Doi:10.1039/DT9790000178
(1979)Doi:10.1021/ja00049a036
(1992)Doi:10.1039/b400248b
(2004)Doi:10.1002/1521-3773(20010518)40:10<1967::AID-ANIE1967>3.0.CO;2-Q
(2001)Doi:10.1007/BF00963317
()Doi:10.1055/s-0035-1561941
(2016)