Products Categories
CAS No.: | 7682-20-4 |
---|---|
Name: | L-2-Aminobutanamide hydrochloride |
Molecular Structure: | |
|
|
Formula: | C4H11ClN2O |
Molecular Weight: | 138.597 |
Synonyms: | Butanamide,2-amino-, monohydrochloride, (2S)- (9CI);Butanamide, 2-amino-,monohydrochloride, (S)-;Butyramide, 2-amino-, monohydrochloride, L- (8CI);(S)-2-Aminobutyramide hydrochloride;L-2-Aminobutanamide hydrochloride; |
EINECS: | 200-001-8 |
Melting Point: | 259-263 °C |
Boiling Point: | 245.7 °C at 760 mmHg |
Flash Point: | 102.4 °C |
Appearance: | Off-white solid |
Hazard Symbols: |
![]() |
Risk Codes: | 22-36/37/38 |
Safety: | 26-36/37 |
PSA: | 69.11000 |
LogP: | 1.41160 |
What can I do for you?
Get Best Price
L-2-Aminobutanamide Hydrochloride, with the CAS register number 7682-20-4, has the systematic name of
(2S)-2-aminobutanamide hydrochloride (1:1). And it is also called as (s)-2-aminobutyramide hydrochloride; aminobutyric acid-nh2 hcl; alpha-aminobutyric acid alpha-amide hydrochloride; 2-aminobutyric acid amide hydrochloride; h-abu(alpha)-nh2 hcl; h-abu(2)-nh2 hcl. It is a kind of white or off-white solid and it is stable and incompatible with oxidizing agents. As for its storing, it should be kept at the temperature of 2-8°C. This chemical is usually used as the chemical reagent and intermediate, such as being the intermediate for Levetiracetam. As for its usage, it is usually used as the pharmaceutic intermediate for the medicine resisting epilepsia and convulsions.
Physical properties about L-2-Aminobutanamide Hydrochloride are: (1)#H bond acceptors: 3; (2)#H bond donors: 4; (3)#Freely Rotating Bonds: 3; (4)Polar Surface Area: 23.55; (5)Flash Point: 102.4 °C; (6)Enthalpy of Vaporization: 48.28 kJ/mol; (7)Boiling Point: 245.7 °C at 760 mmHg; (8)Vapour Pressure: 0.0282 mmHg at 25°C.
You can still convert the following datas into molecular structure:
1. SMILES: Cl.O=C(N)[C@@H](N)CC;
2. InChI: InChI=1/C4H10N2O.ClH/c1-2-3(5)4(6)7;/h3H,2,5H2,1H3,(H2,6,7);1H/t3-;/m0./s1;
3. InChIKey: HDBMIDJFXOYCGK-DFWYDOINBN;