The Trimethobenzamide hydrochloride, with the CAS registry number 554-92-7, is also known as Trimethobenzamide HCl. Its EINECS registry number is 209-075-6. This chemical's molecular formula is C₂₁H₂₉ClN₂O₅ and molecular weight is 424.91836. Its IUPAC name is called N-[[4-[2-(dimethylamino)ethoxy]phenyl]methyl]-3,4,5-trimethoxybenzamide hydrochloride. This chemical's classification codes are Anti-emetic; Drug / Therapeutic Agent.

Physical properties of Trimethobenzamide hydrochloride: (1)ACD/LogP: 1.85; (2)ACD/LogD (pH 5.5): -0.96; (3)ACD/LogD (pH 7.4): 0.6; (4)ACD/BCF (pH 5.5): 1; (5)ACD/BCF (pH 7.4): 1; (6)ACD/KOC (pH 5.5): 1; (7)ACD/KOC (pH 7.4): 13.58; (8)#H bond acceptors: 7; (9)#H bond donors: 1; (10)#Freely Rotating Bonds: 10; (11)Flash Point: 260.4 °C; (12)Enthalpy of Vaporization: 77.69 kJ/mol; (13)Boiling Point: 506.9 °C at 760 mmHg; (14)Vapour Pressure: 2.13E-10 mmHg at 25°C.

You can still convert the following datas into molecular structure:
(1)Canonical SMILES: CN(C)CCOC1=CC=C(C=C1)CNC(=O)C2=CC(=C(C(=C2)OC)OC)OC.Cl
(2)InChI: InChI=1S/C21H28N2O5.ClH/c1-23(2)10-11-28-17-8-6-15(7-9-17)14-22-21(24)16-12-18(25-3)20(27-5)19(13-16)26-4;/h6-9,12-13H,10-11,14H2,1-5H3,(H,22,24);1H
(3)InChIKey: WIIZEEPFHXAUND-UHFFFAOYSA-N

The toxicity data is as follows: