Products Categories
| CAS No.: | 1341-23-7 |
|---|---|
| Name: | Pyridinium,3-(aminocarbonyl)-1-b-D-ribofuranosyl- |
| Molecular Structure: | |
 |
|
| Formula: | C11H15 N2 O5 |
| Molecular Weight: | 272.25454 |
| Synonyms: | Pyridinium,3-carbamoyl-1-b-D-ribofuranosyl-(8CI);3-Pyridinecarboxamide, 1-b-D-ribosyl-;Nicotinamide ribonucleoside;Nicotinamide ribose;Nicotinamide riboside;Ribosylnicotinamide;1-[3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]pyridine-5-carboxamide;nicotinamide-beta-riboside; |
| EINECS: | 1308068-626-2 |
| Density: | 1.201g/cm3 |
| Melting Point: | |
| Boiling Point: | 646.2 °C at 760 mmHg |
| Flash Point: | 344.6 °C |
| Solubility: | |
| Appearance: | |
| Hazard Symbols: | |
| Risk Codes: | |
| Safety: | |
| Transport Information: | |
| PSA: | 116.25000 |
| LogP: | -1.69540 |
Please post your buying leads,so that our qualified suppliers will soon
contact you!
*Required Fields
The Nicotinamide ribose with cas registry number of 1341-23-7, is also called Pyridinium,3-carbamoyl-1-b-D-ribofuranosyl-(8CI) ;3-Pyridinecarboxamide, 1-b-D-ribosyl- .
Physical properties of Nicotinamide ribose :(1)# of Rule of 5 Violations: 1; (2)#H bond acceptors: 8; (3)#H bond donors: 6; (4)#Freely Rotating Bonds: 9; (5)Polar Surface Area: 153.97 Å2; (6)Enthalpy of Vaporization: 100.16 kJ/mol; (7)Vapour Pressure: 1.39E-17 mmHg at 25°C .
You can still convert the following datas into molecular structure:(1)SMILES:NC(=O)c1cccnc1.O=C[C@H](O)[C@H](O)[C@H](O)CO; (2)InChI:InChI=1/C6H6N2O.C5H10O5/c7-6(9)5-2-1-3-8-4-5;6-1-3(8)5(10)4(9)2-7/h1-4H,(H2,7,9);1,3-5,7-10H,2H2/t;3-,4+,5-/m.0/s1; (3)InChIKey:JQZBTYOVGMGUST-HEEXEHOYBT; (4)Std. InChI:InChI=1S/C6H6N2O.C5H10O5/c7-6(9)5-2-1-3-8-4-5;6-1-3(8)5(10)4(9)2-7/h1-4H,(H2,7,9);1,3-5,7-10H,2H2/t;3-,4+,5-/m.0/s1; (5)Std. InChIKey:JQZBTYOVGMGUST-HEEXEHOYSA-N.
