105994-75-0 Usage
General Description
1-Methyl-5-phenyl-1H-pyrazole-4-carboxylic acid is a chemical compound that belongs to the class of organic compounds known as pyrazole carboxylic acids and derivatives. It is a derivative of pyrazole, a five-membered aromatic heterocycle composed of two nitrogen atoms and three carbon atoms in a cyclic structure. 1-METHYL-5-PHENYL-1H-PYRAZOLE-4-CARBOXYLIC ACID is used in the field of organic chemistry and pharmaceuticals research as a building block for the synthesis of other organic molecules and as a potential lead compound for drug development. It is also used as a ligand in coordination chemistry and as a reagent in chemical reactions for the formation of new carbon-carbon or carbon-nitrogen bonds.
Check Digit Verification of cas no
The CAS Registry Mumber 105994-75-0 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,0,5,9,9 and 4 respectively; the second part has 2 digits, 7 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 105994-75:
(8*1)+(7*0)+(6*5)+(5*9)+(4*9)+(3*4)+(2*7)+(1*5)=150
150 % 10 = 0
So 105994-75-0 is a valid CAS Registry Number.
InChI:InChI=1/C11H10N2O2/c1-13-10(8-5-3-2-4-6-8)9(7-12-13)11(14)15/h2-7H,1H3,(H,14,15)
105994-75-0Relevant articles and documents
CALPAIN MODULATORS AND THERAPEUTIC USES THEREOF
-
Paragraph 0578, (2018/04/17)
Disclosed herein are small molecule calpain modulator compositions, pharmaceutical compositions, the use and preparation thereof.
