21577-50-4 Usage
Uses
Used in Organic Synthesis:
2,3-dibromo-4-oxo-but-2-enoic acid is utilized as an intermediate in the synthesis of various organic compounds, contributing to the formation of complex molecules that are essential in different chemical and pharmaceutical processes.
Used in Pharmaceutical Industry:
In the pharmaceutical industry, 2,3-dibromo-4-oxo-but-2-enoic acid is used as an intermediate for the production of pharmaceuticals. Its unique chemical properties allow it to be a key component in the development of new drugs and medicinal compounds.
Used in Biological Research:
2,3-dibromo-4-oxo-but-2-enoic acid is being studied for its potential biological activity, with researchers exploring its possible applications in medicine. This includes investigating its effects on biological systems and its potential as a therapeutic agent.
Safety Considerations:
It is crucial to handle 2,3-dibromo-4-oxo-but-2-enoic acid with care due to its corrosive nature, which can cause skin, eye, and respiratory irritation. Proper safety measures should be taken to minimize exposure and ensure the well-being of those working with 2,3-dibromo-4-oxo-but-2-enoic acid.
Check Digit Verification of cas no
The CAS Registry Mumber 21577-50-4 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,1,5,7 and 7 respectively; the second part has 2 digits, 5 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 21577-50:
(7*2)+(6*1)+(5*5)+(4*7)+(3*7)+(2*5)+(1*0)=104
104 % 10 = 4
So 21577-50-4 is a valid CAS Registry Number.
InChI:InChI=1/C4H2Br2O3/c5-2(1-7)3(6)4(8)9/h1H,(H,8,9)
