609-70-1 Usage
Uses
Used in Chemical Synthesis:
4-Hydroxynicotinic acid is used as a chemical synthesis reagent for the production of various organic compounds. Its unique chemical structure allows it to participate in a wide range of reactions, making it a versatile building block in the synthesis of complex molecules.
Used in Pharmaceutical Industry:
4-Hydroxynicotinic acid is used as an important raw material and intermediate in the pharmaceutical industry. It is a key component in the synthesis of several drugs, including anti-inflammatory agents, antimicrobials, and antiviral medications. Its presence in these drugs contributes to their therapeutic effects and helps in the treatment of various diseases.
Used in Agrochemical Industry:
In the agrochemical industry, 4-Hydroxynicotinic acid is used as a precursor for the synthesis of various agrochemicals, such as pesticides and herbicides. Its incorporation into these products helps in the development of effective solutions for controlling pests and weeds, thereby contributing to increased crop yields and food security.
Used in Dye Industry:
4-Hydroxynicotinic acid is also used in the dye industry as a key intermediate for the synthesis of various dyes and pigments. Its ability to form stable complexes with other molecules makes it an essential component in the production of dyes with specific color properties and stability.
Check Digit Verification of cas no
The CAS Registry Mumber 609-70-1 includes 6 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 3 digits, 6,0 and 9 respectively; the second part has 2 digits, 7 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 609-70:
(5*6)+(4*0)+(3*9)+(2*7)+(1*0)=71
71 % 10 = 1
So 609-70-1 is a valid CAS Registry Number.
InChI:InChI=1/C6H5NO3/c8-5-1-2-7-3-4(5)6(9)10/h1-3H,(H,7,8)(H,9,10)
