543-94-2 Usage
Uses
1. Laboratory Reagent:
Strontium acetate is used as a laboratory reagent for various chemical analyses and experiments due to its unique chemical properties.
2. Dental Toothpaste:
In the dental industry, strontium acetate is used as an ingredient in toothpaste formulations to help strengthen teeth and prevent tooth decay.
3. Catalysts:
Strontium acetate serves as a catalyst in the chemical industry, facilitating various chemical reactions and improving the efficiency of production processes.
4. Chemical Intermediates:
As a chemical intermediate, strontium acetate is used in the synthesis of other chemicals and compounds, contributing to the development of new materials and products.
5. Medicines:
Strontium acetate is utilized in the pharmaceutical industry for the development of medicines, taking advantage of its unique properties to create effective treatments for various health conditions.
6. Superconductor Wire:
Strontium acetate acts as a precursor to promising candidate materials for superconductor wire, which has the potential to revolutionize energy transmission and electronic devices due to their ability to conduct electricity without resistance.
Production Methods
Strontium acetate, white crystals, soluble, formed by reaction of strontium carbonate or hydroxide and acetic acid.
Flammability and Explosibility
Notclassified
Purification Methods
Crystallise it from AcOH, then dry it under vacuum for 24hours at 100o. [Beilstein 2 II 91.]
Check Digit Verification of cas no
The CAS Registry Mumber 543-94-2 includes 6 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 3 digits, 5,4 and 3 respectively; the second part has 2 digits, 9 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 543-94:
(5*5)+(4*4)+(3*3)+(2*9)+(1*4)=72
72 % 10 = 2
So 543-94-2 is a valid CAS Registry Number.
InChI:InChI=1/C2H4O2.Sr/c1-2(3)4;/h1H3,(H,3,4);/q;+2/p-1
543-94-2Relevant articles and documents
Preparation of Bi-based high-Tc superconducting films from methacrylate solutions
Men'shikh,Geras'kina,Prutchenko,Rybakova,Tomashpol'skii
, p. 517 - 520 (2008/10/08)
Bi2Sr2CaCu2Ox superconducting films containing minor amounts of Bi2Sr2Ca2Cu3Ox were prepared by spray pyrolysis of methacrylate solutions on LaAlO3 substrates. The best superconducting properties (Tc ? 80 K, ΔTc ? 10 K) were shown by the films annealed at 850°C, which consisted mainly of platelike crystallites with a high degree of [001] orientation. The composition, content, and morphology of the calcium strontium cuprates and oxides present as impurity phases were found to correlate with the annealing temperature and film thickness.