
Journal of Organometallic Chemistry p. 119 - 128 (1997)
Update date:2022-08-05
Topics:
Elgafi, Sarah
Field, Leslie D.
Messerle, Barbara A.
Buys, Irmi E.
Hambley, Trevor W.
The preparation and characterisation of ruthenium(II) and osmium(II) complexes with the trisimidazole ligands tris(N-methylimidazol-2-yl)methanol (1a) ((mim)3COH) and tris(N-ethoxymethylimidazol-2-yl)methanol (1b) ((emim)3COH) are reported (mim = N-methylimidazol-2-yl, emim = N-ethoxymethylimidazol-2-yl). The complex [{RuCl(PPh3)2((mim)3COH)}+Cl-] (2) was formed by the reaction of (mim)3COH with [RuCl2(PPh3)4]. The complexes [{Ru(PPh3)(CO)H((mim)3COH)}+Cl-] (3a) and [{Ru(PPh3)(CO)H((emim)3COH)}+Cl-] (3b) were formed by the reaction of (mim)3COH or (emim)3COH (respectively) with [Ru(PPh3)3HCl(CO)]. Likewise, the reaction of (mim)3COH or (emim)3COH (respectively) with [Os(PPh3)3HCl(CO)] formed [{Os(PPh3)(CO)H((mim)3COH)}+Cl-] (4a) and [{Os(PPh3)(CO)H((emim)3COH)}+Cl-] (4b). The ruthenium monohydride complex [{Ru(PPh3)(CO)H((mim)3COH)}+Cl-] (3a) adds to the terminal C-H bond of phenylacetylene to form the vinyl complex [{Ru(PPh3)(CO)(CH=CHPh)((mim)3COH)}+Cl-] (5). The air-stable complexes were characterised by multinuclear NMR spectroscopy and 2 and 3b were characterised by X-ray crystallography. Crystals of 2, C49H46N6OP2RuCl2, M 968.87, are triclinic, space group P1, a = 12.011(5), b = 13.342(3), c = 16.554(6) A, α = 89.26(3)°, β = 76.94(3)°, γ = 77.43(3)°, Ζ = 2. Crystals of 3b, C38H44N6O5PRuCl, Μ 832.30, are triclinic, space group P1, a = 12.759(3), b= 13.017(2), c= 13.167(4) A, α = 87.65(2)°, β = 64.09(2)°, γ = 88.82(2)°, Ζ =2.
View MoreShanghai shibo Chemical Co., Ltd
Contact:+86-021-60753516
Address:688 Qiushi Road, Jinshan High-tech Park, Shanghai, China,201512
Contact:+86-021-50792271
Address:Building 24A, 300 Chuantu Road, Chuansha, Pudong new area, Shanghai, China, 201202
website:http://www.jairadhesales.com
Contact:0091-79-26431096
Address:309 Harikrupa Tower,Nr old Sharda Mandir Char Rasta,Ellisbridge
Kunshan Yalong Trading Co,.Ltd
Contact:86-512-57621185
Address:805-807 Room Hongqiao Mansion ,1088 West Qianjin Road, Kunshan, Jiangsu,China
Changzhou Hopschain Chemical Co.,Ltd
website:http://www.hopschem.cn/products.html
Contact:86-519-85528066
Address:Room 710, Unit A, Xingbei Development Mansion, Tongjiang Road, Changzhou City,213000, China
Doi:10.1002/prac.19973390162
(1997)Doi:10.1016/S0040-4039(97)00962-3
(1997)Doi:10.1021/jo01259a016
(1969)Doi:10.1021/ja971259t
(1997)Doi:10.1002/adsc.201901254
(2020)Doi:10.1021/jm00310a024
(1968)